C21H23FN2O3 — CID 67592974
2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-propoxyphenol (PubChem CID 67592974) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-propoxyphenol.
| Compound Name | 2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-propoxyphenol |
|---|---|
| PubChem CID | 67592974 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-propoxyphenol |
| SMILES | CCCOc1cccc(O)c1N1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C21H23FN2O3/c1-2-12-26-18-5-3-4-17(25)21(18)24-10-8-14(9-11-24)20-16-7-6-15(22)13-19(16)27-23-20/h3-7,13-14,25H,2,8-12H2,1H3 |
| InChIKey | DMNPLUQFQGCZKT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |