C29H41NO4 — CID 67602244
1,10-dimethoxy-6-methyl-3,4-dipentyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol (PubChem CID 67602244) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is 1,10-dimethoxy-6-methyl-3,4-dipentyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol.
| Compound Name | 1,10-dimethoxy-6-methyl-3,4-dipentyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
|---|---|
| PubChem CID | 67602244 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 1,10-dimethoxy-6-methyl-3,4-dipentyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
| SMILES | CCCCCc1c(O)c(OC)c2c3c1C(CCCCC)CN(C)C3Cc1cc(O)c(OC)cc1-2 |
| InChI | InChI=1S/C29H41NO4/c1-6-8-10-12-18-17-30(3)22-14-19-15-23(31)24(33-4)16-21(19)26-27(22)25(18)20(13-11-9-7-2)28(32)29(26)34-5/h15-16,18,22,31-32H,6-14,17H2,1-5H3 |
| InChIKey | WIXUDOIAVVQKRC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|