C25H23F5N4O3 — CID 67602923
3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid (PubChem CID 67602923) has the molecular formula C25H23F5N4O3 and a molecular weight of 522.47 g/mol. Its IUPAC name is 3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid.
| Compound Name | 3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid |
|---|---|
| PubChem CID | 67602923 |
| Molecular Formula | C25H23F5N4O3 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid |
| SMILES | NN/C=N/c1cc(C(=O)NCc2cccc(C3(F)C=C(F)C=C(CCC(=O)O)C3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H23F5N4O3/c26-20-7-15(4-5-22(35)36)11-24(27,12-20)18-3-1-2-16(6-18)13-32-23(37)17-8-19(25(28,29)30)10-21(9-17)33-14-34-31/h1-3,6-10,12,14H,4-5,11,13,31H2,(H,32,37)(H,33,34)(H,35,36) |
| InChIKey | GCCIKQZAFOHUSF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|