C23H23N3O3 — CID 67616103
3-[3-(hydrazinylmethylideneamino)phenyl]-2-methoxy-2,3-diphenylpropanoic acid (PubChem CID 67616103) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-[3-(hydrazinylmethylideneamino)phenyl]-2-methoxy-2,3-diphenylpropanoic acid.
| Compound Name | 3-[3-(hydrazinylmethylideneamino)phenyl]-2-methoxy-2,3-diphenylpropanoic acid |
|---|---|
| PubChem CID | 67616103 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-[3-(hydrazinylmethylideneamino)phenyl]-2-methoxy-2,3-diphenylpropanoic acid |
| SMILES | COC(C(=O)O)(c1ccccc1)C(c1ccccc1)c1cccc(/N=C/NN)c1 |
| InChI | InChI=1S/C23H23N3O3/c1-29-23(22(27)28,19-12-6-3-7-13-19)21(17-9-4-2-5-10-17)18-11-8-14-20(15-18)25-16-26-24/h2-16,21H,24H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | TYNLQFOPIUMANM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|