About 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid
3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid (PubChem CID 173309447) has the molecular formula C19H20N4O3
and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid |
| PubChem CID | 173309447 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid |
| SMILES | Cc1cc(C)cc(C(C(=O)O)=C(N)C(=O)c2cccc(/N=C/NN)c2)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-11-6-12(2)8-14(7-11)16(19(25)26)17(20)18(24)13-4-3-5-15(9-13)22-10-23-21/h3-10H,20-21H2,1-2H3,(H,22,23)(H,25,26) |
| InChIKey | YONNSVXWCKTTDF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid?
The IUPAC name of 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid (CID 173309447) is 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid.
What is the SMILES notation for 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid?
The canonical SMILES for 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid is Cc1cc(C)cc(C(C(=O)O)=C(N)C(=O)c2cccc(/N=C/NN)c2)c1.
What is the InChIKey of 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid?
The InChIKey is YONNSVXWCKTTDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3/c1-11-6-12(2)8-14(7-11)16(19(25)26)17(20)18(24)13-4-3-5-15(9-13)22-10-23-21/h3-10H,20-21H2,1-2H3,(H,22,23)(H,25,26).
What are the key properties of 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid?
3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid has a molecular weight of 352.39 g/mol, XLogP of 2.06, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3,5-dimethylphenyl)-4-[3-(hydrazinylmethylideneamino)phenyl]-4-oxobut-2-enoic acid is sourced from PubChem (CID 173309447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).