C21H20O3S2 — CID 67617978
1,2-dimethyl-4-(4-phenylmethoxyphenyl)sulfanylsulfonylbenzene (PubChem CID 67617978) has the molecular formula C21H20O3S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1,2-dimethyl-4-(4-phenylmethoxyphenyl)sulfanylsulfonylbenzene.
| Compound Name | 1,2-dimethyl-4-(4-phenylmethoxyphenyl)sulfanylsulfonylbenzene |
|---|---|
| PubChem CID | 67617978 |
| Molecular Formula | C21H20O3S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1,2-dimethyl-4-(4-phenylmethoxyphenyl)sulfanylsulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)Sc2ccc(OCc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C21H20O3S2/c1-16-8-13-21(14-17(16)2)26(22,23)25-20-11-9-19(10-12-20)24-15-18-6-4-3-5-7-18/h3-14H,15H2,1-2H3 |
| InChIKey | LQGZZURAQIYWBL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|