C12H14Cl2 — CID 67630607
1,2-dichloro-4-[(3R)-hex-4-en-3-yl]benzene (PubChem CID 67630607) has the molecular formula C12H14Cl2 and a molecular weight of 229.15 g/mol. Its IUPAC name is 1,2-dichloro-4-[(3R)-hex-4-en-3-yl]benzene.
| Compound Name | 1,2-dichloro-4-[(3R)-hex-4-en-3-yl]benzene |
|---|---|
| PubChem CID | 67630607 |
| Molecular Formula | C12H14Cl2 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1,2-dichloro-4-[(3R)-hex-4-en-3-yl]benzene |
| SMILES | CC=C[C@@H](CC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2/c1-3-5-9(4-2)10-6-7-11(13)12(14)8-10/h3,5-9H,4H2,1-2H3/t9-/m1/s1 |
| InChIKey | OHJOYKJRQSZHAY-SECBINFHSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|