C17H25ClO3 — CID 67633723
2-[4-chloro-3-(2-ethylhexyl)-2-methylphenoxy]acetic acid (PubChem CID 67633723) has the molecular formula C17H25ClO3 and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-[4-chloro-3-(2-ethylhexyl)-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-chloro-3-(2-ethylhexyl)-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 67633723 |
| Molecular Formula | C17H25ClO3 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[4-chloro-3-(2-ethylhexyl)-2-methylphenoxy]acetic acid |
| SMILES | CCCCC(CC)Cc1c(Cl)ccc(OCC(=O)O)c1C |
| InChI | InChI=1S/C17H25ClO3/c1-4-6-7-13(5-2)10-14-12(3)16(9-8-15(14)18)21-11-17(19)20/h8-9,13H,4-7,10-11H2,1-3H3,(H,19,20) |
| InChIKey | NNKOVULNPSQPFV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |