C32H24Cl4O8 — CID 150766906
1,6,7,12-tetrachloro-2-(2-ethylhexyl)perylene-3,4,9,10-tetracarboxylic acid (PubChem CID 150766906) has the molecular formula C32H24Cl4O8 and a molecular weight of 678.35 g/mol. Its IUPAC name is 1,6,7,12-tetrachloro-2-(2-ethylhexyl)perylene-3,4,9,10-tetracarboxylic acid.
| Compound Name | 1,6,7,12-tetrachloro-2-(2-ethylhexyl)perylene-3,4,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 150766906 |
| Molecular Formula | C32H24Cl4O8 |
| Molecular Weight | 678.35 g/mol |
| Exact Mass | 676.02 |
| IUPAC Name | 1,6,7,12-tetrachloro-2-(2-ethylhexyl)perylene-3,4,9,10-tetracarboxylic acid |
| SMILES | CCCCC(CC)Cc1c(C(=O)O)c2c(C(=O)O)cc(Cl)c3c4c(Cl)cc(C(=O)O)c5c(C(=O)O)cc(Cl)c(c(c1Cl)c23)c54 |
| InChI | InChI=1S/C32H24Cl4O8/c1-3-5-6-11(4-2)7-12-21(32(43)44)20-15(31(41)42)10-17(34)23-22-16(33)8-13(29(37)38)19-14(30(39)40)9-18(35)24(25(19)22)27(26(20)23)28(12)36/h8-11H,3-7H2,1-2H3,(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | JZALVCAKCLJIFF-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.35 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|