C38H33N3O2 — CID 67637419
5-amino-3,3-bis(9-ethylcarbazol-3-yl)-4,6-dimethyl-2-benzofuran-1-one (PubChem CID 67637419) has the molecular formula C38H33N3O2 and a molecular weight of 563.70 g/mol. Its IUPAC name is 5-amino-3,3-bis(9-ethylcarbazol-3-yl)-4,6-dimethyl-2-benzofuran-1-one.
| Compound Name | 5-amino-3,3-bis(9-ethylcarbazol-3-yl)-4,6-dimethyl-2-benzofuran-1-one |
|---|---|
| PubChem CID | 67637419 |
| Molecular Formula | C38H33N3O2 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 5-amino-3,3-bis(9-ethylcarbazol-3-yl)-4,6-dimethyl-2-benzofuran-1-one |
| SMILES | CCn1c2ccccc2c2cc(C3(c4ccc5c(c4)c4ccccc4n5CC)OC(=O)c4cc(C)c(N)c(C)c43)ccc21 |
| InChI | InChI=1S/C38H33N3O2/c1-5-40-31-13-9-7-11-26(31)28-20-24(15-17-33(28)40)38(35-23(4)36(39)22(3)19-30(35)37(42)43-38)25-16-18-34-29(21-25)27-12-8-10-14-32(27)41(34)6-2/h7-21H,5-6,39H2,1-4H3 |
| InChIKey | JZLGHZVCXJALHF-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|