C38H43NO4S — CID 67659332
4-[4-[[4-[bis(4-propylphenyl)methylsulfanyl]-2,3-dimethylbenzoyl]amino]phenoxy]butanoic acid (PubChem CID 67659332) has the molecular formula C38H43NO4S and a molecular weight of 609.83 g/mol. Its IUPAC name is 4-[4-[[4-[bis(4-propylphenyl)methylsulfanyl]-2,3-dimethylbenzoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[4-[bis(4-propylphenyl)methylsulfanyl]-2,3-dimethylbenzoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67659332 |
| Molecular Formula | C38H43NO4S |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | 4-[4-[[4-[bis(4-propylphenyl)methylsulfanyl]-2,3-dimethylbenzoyl]amino]phenoxy]butanoic acid |
| SMILES | CCCc1ccc(C(Sc2ccc(C(=O)Nc3ccc(OCCCC(=O)O)cc3)c(C)c2C)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C38H43NO4S/c1-5-8-28-11-15-30(16-12-28)37(31-17-13-29(9-6-2)14-18-31)44-35-24-23-34(26(3)27(35)4)38(42)39-32-19-21-33(22-20-32)43-25-7-10-36(40)41/h11-24,37H,5-10,25H2,1-4H3,(H,39,42)(H,40,41) |
| InChIKey | LVFQQADUVAMIAO-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|