C16H21F3N4O3 — CID 67666121
(1-methanehydrazonoylpiperidin-4-yl) 2-amino-2-methoxy-2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 67666121) has the molecular formula C16H21F3N4O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is (1-methanehydrazonoylpiperidin-4-yl) 2-amino-2-methoxy-2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | (1-methanehydrazonoylpiperidin-4-yl) 2-amino-2-methoxy-2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 67666121 |
| Molecular Formula | C16H21F3N4O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (1-methanehydrazonoylpiperidin-4-yl) 2-amino-2-methoxy-2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(N)(C(=O)OC1CCN(C=NN)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N4O3/c1-25-15(20,11-3-2-4-12(9-11)16(17,18)19)14(24)26-13-5-7-23(8-6-13)10-22-21/h2-4,9-10,13H,5-8,20-21H2,1H3 |
| InChIKey | FMNQGFAMLQMKNX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|