C22H25IN2O7S — CID 67706836
2-[4-[[(2S)-2-[(4-iodophenyl)sulfonylamino]-3-(oxan-2-yloxy)propanoyl]amino]phenyl]acetic acid (PubChem CID 67706836) has the molecular formula C22H25IN2O7S and a molecular weight of 588.42 g/mol. Its IUPAC name is 2-[4-[[(2S)-2-[(4-iodophenyl)sulfonylamino]-3-(oxan-2-yloxy)propanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(2S)-2-[(4-iodophenyl)sulfonylamino]-3-(oxan-2-yloxy)propanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 67706836 |
| Molecular Formula | C22H25IN2O7S |
| Molecular Weight | 588.42 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | 2-[4-[[(2S)-2-[(4-iodophenyl)sulfonylamino]-3-(oxan-2-yloxy)propanoyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)[C@H](COC2CCCCO2)NS(=O)(=O)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C22H25IN2O7S/c23-16-6-10-18(11-7-16)33(29,30)25-19(14-32-21-3-1-2-12-31-21)22(28)24-17-8-4-15(5-9-17)13-20(26)27/h4-11,19,21,25H,1-3,12-14H2,(H,24,28)(H,26,27)/t19-,21?/m0/s1 |
| InChIKey | UIIXENIEDMGDAT-ZQRQZVKFSA-N |
| XLogP | 2.75 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|