C22H29BrO5 — CID 67710669
(1S,2R,10S,11S,14R,15S)-9-bromo-14,17-dihydroxy-14-(2-hydroxyacetyl)-2,15-dimethylpentacyclo[8.7.0.02,7.04,13.011,15]heptadeca-3,6-dien-5-one;methane (PubChem CID 67710669) has the molecular formula C22H29BrO5 and a molecular weight of 453.37 g/mol. Its IUPAC name is (1S,2R,10S,11S,14R,15S)-9-bromo-14,17-dihydroxy-14-(2-hydroxyacetyl)-2,15-dimethylpentacyclo[8.7.0.02,7.04,13.011,15]heptadeca-3,6-dien-5-one;methane.
| Compound Name | (1S,2R,10S,11S,14R,15S)-9-bromo-14,17-dihydroxy-14-(2-hydroxyacetyl)-2,15-dimethylpentacyclo[8.7.0.02,7.04,13.011,15]heptadeca-3,6-dien-5-one;methane |
|---|---|
| PubChem CID | 67710669 |
| Molecular Formula | C22H29BrO5 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (1S,2R,10S,11S,14R,15S)-9-bromo-14,17-dihydroxy-14-(2-hydroxyacetyl)-2,15-dimethylpentacyclo[8.7.0.02,7.04,13.011,15]heptadeca-3,6-dien-5-one;methane |
| SMILES | C.C[C@]12C=C3C(=O)C=C1CC(Br)[C@@H]1[C@@H]2C(O)C[C@@]2(C)[C@H]1CC3[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C21H25BrO5.CH4/c1-19-6-10-11-5-12-17(13(22)3-9(19)4-14(10)24)18(19)15(25)7-20(12,2)21(11,27)16(26)8-23;/h4,6,11-13,15,17-18,23,25,27H,3,5,7-8H2,1-2H3;1H4/t11?,12-,13?,15?,17+,18-,19-,20-,21-;/m0./s1 |
| InChIKey | XQTCUQHNGFJIBO-IDWPRVMPSA-N |
| XLogP | 2.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|