C25H29NO5S2 — CID 67713088
N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylthiophene-2-sulfonamide (PubChem CID 67713088) has the molecular formula C25H29NO5S2 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylthiophene-2-sulfonamide.
| Compound Name | N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 67713088 |
| Molecular Formula | C25H29NO5S2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylthiophene-2-sulfonamide |
| SMILES | CCCC(c1c(O)c2c(oc1=O)CCCCCC2)N(c1ccccc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C25H29NO5S2/c1-2-11-20(23-24(27)19-14-8-3-4-9-15-21(19)31-25(23)28)26(18-12-6-5-7-13-18)33(29,30)22-16-10-17-32-22/h5-7,10,12-13,16-17,20,27H,2-4,8-9,11,14-15H2,1H3 |
| InChIKey | NSRRZPPJWCBOSB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |