C18H26O — CID 67724793
(5R,8R,9R,10S,13S)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 67724793) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (5R,8R,9R,10S,13S)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8R,9R,10S,13S)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 67724793 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (5R,8R,9R,10S,13S)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3[C@H]4CCCC[C@@H]4CC[C@H]3C1=CCC2=O |
| InChI | InChI=1S/C18H26O/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19/h8,12-15H,2-7,9-11H2,1H3/t12-,13+,14-,15-,18+/m1/s1 |
| InChIKey | DDSOHWWGZUEJAF-VTWRMFPLSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|