C28H30N4O5 — CID 67731842
but-2-enedioic acid;8-[4-(4-methylpiperazin-1-yl)but-2-ynyl]-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-one (PubChem CID 67731842) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is but-2-enedioic acid;8-[4-(4-methylpiperazin-1-yl)but-2-ynyl]-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-one.
| Compound Name | but-2-enedioic acid;8-[4-(4-methylpiperazin-1-yl)but-2-ynyl]-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-one |
|---|---|
| PubChem CID | 67731842 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | but-2-enedioic acid;8-[4-(4-methylpiperazin-1-yl)but-2-ynyl]-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-9-one |
| SMILES | CN1CCN(CC#CCN2C(=O)c3cccc4c3N(CC4)c3ccccc32)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H26N4O.C4H4O4/c1-25-15-17-26(18-16-25)12-4-5-13-28-22-10-3-2-9-21(22)27-14-11-19-7-6-8-20(23(19)27)24(28)29;5-3(6)1-2-4(7)8/h2-3,6-10H,11-18H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JVSAHDPMIGEHKF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|