C16H23BrO8 — CID 67734682
[(3R,4S,5R,6R)-3,5-diacetyloxy-2-bromo-6-[(1S)-1-prop-2-enoxyethyl]oxan-4-yl] acetate (PubChem CID 67734682) has the molecular formula C16H23BrO8 and a molecular weight of 423.26 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-3,5-diacetyloxy-2-bromo-6-[(1S)-1-prop-2-enoxyethyl]oxan-4-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-3,5-diacetyloxy-2-bromo-6-[(1S)-1-prop-2-enoxyethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 67734682 |
| Molecular Formula | C16H23BrO8 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | [(3R,4S,5R,6R)-3,5-diacetyloxy-2-bromo-6-[(1S)-1-prop-2-enoxyethyl]oxan-4-yl] acetate |
| SMILES | C=CCO[C@@H](C)[C@H]1OC(Br)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H23BrO8/c1-6-7-21-8(2)12-13(22-9(3)18)14(23-10(4)19)15(16(17)25-12)24-11(5)20/h6,8,12-16H,1,7H2,2-5H3/t8-,12+,13-,14-,15+,16?/m0/s1 |
| InChIKey | UBDADQVWRNDNMO-ISRMOHHPSA-N |
| XLogP | 1.49 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|