C22H34N4O3 — CID 67745009
ethyl (2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-5-yl)hexanoyl]amino]pentanoate (PubChem CID 67745009) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-5-yl)hexanoyl]amino]pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-5-yl)hexanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 67745009 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | ethyl (2S)-4-methyl-2-[methyl-[6-(2-methylimidazo[4,5-c]pyridin-5-yl)hexanoyl]amino]pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)N(C)C(=O)CCCCCn1ccc2nc(C)nc-2c1 |
| InChI | InChI=1S/C22H34N4O3/c1-6-29-22(28)20(14-16(2)3)25(5)21(27)10-8-7-9-12-26-13-11-18-19(15-26)24-17(4)23-18/h11,13,15-16,20H,6-10,12,14H2,1-5H3/t20-/m0/s1 |
| InChIKey | FMKIAWPJOKZYTR-FQEVSTJZSA-N |
| XLogP | 3.69 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|