C14H13NO4 — CID 67746435
1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid (PubChem CID 67746435) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid.
| Compound Name | 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 67746435 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
| SMILES | Nc1ccccc1C1(C(=O)O)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C14H13NO4/c15-11-4-2-1-3-10(11)14(13(18)19)7-5-9(6-8-14)12(16)17/h1-9H,15H2,(H,16,17)(H,18,19) |
| InChIKey | OSLPIYADPKBKAR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|