About 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid
1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid (PubChem CID 67746435) has the molecular formula C14H13NO4
and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
| PubChem CID | 67746435 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid |
| SMILES | Nc1ccccc1C1(C(=O)O)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C14H13NO4/c15-11-4-2-1-3-10(11)14(13(18)19)7-5-9(6-8-14)12(16)17/h1-9H,15H2,(H,16,17)(H,18,19) |
| InChIKey | OSLPIYADPKBKAR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid?
The IUPAC name of 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid (CID 67746435) is 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid.
What is the SMILES notation for 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid?
The canonical SMILES for 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid is Nc1ccccc1C1(C(=O)O)C=CC(C(=O)O)C=C1.
What is the InChIKey of 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid?
The InChIKey is OSLPIYADPKBKAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c15-11-4-2-1-3-10(11)14(13(18)19)7-5-9(6-8-14)12(16)17/h1-9H,15H2,(H,16,17)(H,18,19).
What are the key properties of 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid?
1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid has a molecular weight of 259.26 g/mol, XLogP of 1.42, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminophenyl)cyclohexa-2,5-diene-1,4-dicarboxylic acid is sourced from PubChem (CID 67746435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).