C16H18O3 — CID 22307876
4-ethoxy-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 22307876) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-ethoxy-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-ethoxy-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 22307876 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 4-ethoxy-4-(2-methylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCOC1(c2ccccc2C)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C16H18O3/c1-3-19-16(14-7-5-4-6-12(14)2)10-8-13(9-11-16)15(17)18/h4-11,13H,3H2,1-2H3,(H,17,18) |
| InChIKey | LONOZGPDTJKXBF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|