C27H44N4O5 — CID 67755604
ethyl 1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,4-dihydroquinazoline-3-carboxylate (PubChem CID 67755604) has the molecular formula C27H44N4O5 and a molecular weight of 504.67 g/mol. Its IUPAC name is ethyl 1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,4-dihydroquinazoline-3-carboxylate.
| Compound Name | ethyl 1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,4-dihydroquinazoline-3-carboxylate |
|---|---|
| PubChem CID | 67755604 |
| Molecular Formula | C27H44N4O5 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | ethyl 1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,4-dihydroquinazoline-3-carboxylate |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)CC(C)(C)CC(=O)N1CN(C(=O)OCC)Cc2ccccc21 |
| InChI | InChI=1S/C27H44N4O5/c1-6-8-13-29-25(34)19(3)14-23(32)21(28)15-27(4,5)16-24(33)31-18-30(26(35)36-7-2)17-20-11-9-10-12-22(20)31/h9-12,19,21,23,32H,6-8,13-18,28H2,1-5H3,(H,29,34)/t19-,21+,23+/m1/s1 |
| InChIKey | BMSBQDPXLDFVOR-NWSQWKLXSA-N |
| XLogP | 3.39 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|