C18H22O — CID 67768326
4-[2-(2-pentylcyclopenta-2,4-dien-1-ylidene)ethyl]phenol (PubChem CID 67768326) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-[2-(2-pentylcyclopenta-2,4-dien-1-ylidene)ethyl]phenol.
| Compound Name | 4-[2-(2-pentylcyclopenta-2,4-dien-1-ylidene)ethyl]phenol |
|---|---|
| PubChem CID | 67768326 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-[2-(2-pentylcyclopenta-2,4-dien-1-ylidene)ethyl]phenol |
| SMILES | CCCCCC1=CC=CC1=CCc1ccc(O)cc1 |
| InChI | InChI=1S/C18H22O/c1-2-3-4-6-16-7-5-8-17(16)12-9-15-10-13-18(19)14-11-15/h5,7-8,10-14,19H,2-4,6,9H2,1H3 |
| InChIKey | NVWGXYWGMCGYSM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|