C20H27N3O2 — CID 67773013
(2S)-2-[[(E,1S)-1-cyclopropyl-4-(2,3-dihydroindol-1-yl)-4-oxobut-2-enyl]amino]-3-methylbutanamide (PubChem CID 67773013) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (2S)-2-[[(E,1S)-1-cyclopropyl-4-(2,3-dihydroindol-1-yl)-4-oxobut-2-enyl]amino]-3-methylbutanamide.
| Compound Name | (2S)-2-[[(E,1S)-1-cyclopropyl-4-(2,3-dihydroindol-1-yl)-4-oxobut-2-enyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 67773013 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (2S)-2-[[(E,1S)-1-cyclopropyl-4-(2,3-dihydroindol-1-yl)-4-oxobut-2-enyl]amino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N[C@H](/C=C/C(=O)N1CCc2ccccc21)C1CC1)C(N)=O |
| InChI | InChI=1S/C20H27N3O2/c1-13(2)19(20(21)25)22-16(14-7-8-14)9-10-18(24)23-12-11-15-5-3-4-6-17(15)23/h3-6,9-10,13-14,16,19,22H,7-8,11-12H2,1-2H3,(H2,21,25)/b10-9+/t16-,19+/m1/s1 |
| InChIKey | CDRGSOLIRVUKMR-HBTVWZBFSA-N |
| XLogP | 2.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|