C32H45N3O3 — CID 67791631
[3-[[4-(diethylcarbamoyl)phenyl]-(2,5-dimethyl-4-prop-2-enylpiperazin-1-yl)methyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 67791631) has the molecular formula C32H45N3O3 and a molecular weight of 519.73 g/mol. Its IUPAC name is [3-[[4-(diethylcarbamoyl)phenyl]-(2,5-dimethyl-4-prop-2-enylpiperazin-1-yl)methyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[[4-(diethylcarbamoyl)phenyl]-(2,5-dimethyl-4-prop-2-enylpiperazin-1-yl)methyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67791631 |
| Molecular Formula | C32H45N3O3 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | [3-[[4-(diethylcarbamoyl)phenyl]-(2,5-dimethyl-4-prop-2-enylpiperazin-1-yl)methyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C=CCN1CC(C)N(C(c2ccc(C(=O)N(CC)CC)cc2)c2cccc(OC(=O)C(C)(C)C)c2)CC1C |
| InChI | InChI=1S/C32H45N3O3/c1-9-19-34-21-24(5)35(22-23(34)4)29(25-15-17-26(18-16-25)30(36)33(10-2)11-3)27-13-12-14-28(20-27)38-31(37)32(6,7)8/h9,12-18,20,23-24,29H,1,10-11,19,21-22H2,2-8H3 |
| InChIKey | HRYJTRALVUSLDR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|