C28H36F3N3O4S — CID 87694085
[3-[(R)-[3-(diethylcarbamoyl)phenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87694085) has the molecular formula C28H36F3N3O4S and a molecular weight of 567.67 g/mol. Its IUPAC name is [3-[(R)-[3-(diethylcarbamoyl)phenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[(R)-[3-(diethylcarbamoyl)phenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87694085 |
| Molecular Formula | C28H36F3N3O4S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | [3-[(R)-[3-(diethylcarbamoyl)phenyl]-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | C=CCN1C[C@H](C)N(C(c2cccc(OS(=O)(=O)C(F)(F)F)c2)c2cccc(C(=O)N(CC)CC)c2)C[C@H]1C |
| InChI | InChI=1S/C28H36F3N3O4S/c1-6-15-33-18-21(5)34(19-20(33)4)26(22-11-9-13-24(16-22)27(35)32(7-2)8-3)23-12-10-14-25(17-23)38-39(36,37)28(29,30)31/h6,9-14,16-17,20-21,26H,1,7-8,15,18-19H2,2-5H3/t20-,21+,26?/m1/s1 |
| InChIKey | IKWUBBJNTZBVMX-CFNLWSCMSA-N |
| XLogP | 5.07 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|