C32H38O4Si — CID 67791991
(4S)-3-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 67791991) has the molecular formula C32H38O4Si and a molecular weight of 514.74 g/mol. Its IUPAC name is (4S)-3-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (4S)-3-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 67791991 |
| Molecular Formula | C32H38O4Si |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (4S)-3-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]methyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](OCCc1cccc(CC2C(C(=O)O)C3CC[C@@H]2O3)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38O4Si/c1-32(2,3)37(25-13-6-4-7-14-25,26-15-8-5-9-16-26)35-20-19-23-11-10-12-24(21-23)22-27-28-17-18-29(36-28)30(27)31(33)34/h4-16,21,27-30H,17-20,22H2,1-3H3,(H,33,34)/t27?,28-,29?,30?/m0/s1 |
| InChIKey | KNKMSJQWAQTNLN-WJKUOXBKSA-N |
| XLogP | 5.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|