C15H18BrClN2O — CID 67796278
N-[1-(4-bromo-2-chlorophenyl)ethyl]-2-cyano-3,3-dimethylbutanamide (PubChem CID 67796278) has the molecular formula C15H18BrClN2O and a molecular weight of 357.68 g/mol. Its IUPAC name is N-[1-(4-bromo-2-chlorophenyl)ethyl]-2-cyano-3,3-dimethylbutanamide.
| Compound Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-2-cyano-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 67796278 |
| Molecular Formula | C15H18BrClN2O |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | N-[1-(4-bromo-2-chlorophenyl)ethyl]-2-cyano-3,3-dimethylbutanamide |
| SMILES | CC(NC(=O)C(C#N)C(C)(C)C)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H18BrClN2O/c1-9(11-6-5-10(16)7-13(11)17)19-14(20)12(8-18)15(2,3)4/h5-7,9,12H,1-4H3,(H,19,20) |
| InChIKey | CUZRQUCSOCTCIO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |