C29H31Cl2N5O5S — CID 67796512
4-[[5-chloro-3-(2-chlorophenyl)-7-[4-(diethylcarbamoylamino)phenyl]sulfonyl-2-oxo-1H-indol-3-yl]amino]butanamide (PubChem CID 67796512) has the molecular formula C29H31Cl2N5O5S and a molecular weight of 632.57 g/mol. Its IUPAC name is 4-[[5-chloro-3-(2-chlorophenyl)-7-[4-(diethylcarbamoylamino)phenyl]sulfonyl-2-oxo-1H-indol-3-yl]amino]butanamide.
| Compound Name | 4-[[5-chloro-3-(2-chlorophenyl)-7-[4-(diethylcarbamoylamino)phenyl]sulfonyl-2-oxo-1H-indol-3-yl]amino]butanamide |
|---|---|
| PubChem CID | 67796512 |
| Molecular Formula | C29H31Cl2N5O5S |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | 4-[[5-chloro-3-(2-chlorophenyl)-7-[4-(diethylcarbamoylamino)phenyl]sulfonyl-2-oxo-1H-indol-3-yl]amino]butanamide |
| SMILES | CCN(CC)C(=O)Nc1ccc(S(=O)(=O)c2cc(Cl)cc3c2NC(=O)C3(NCCCC(N)=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C29H31Cl2N5O5S/c1-3-36(4-2)28(39)34-19-11-13-20(14-12-19)42(40,41)24-17-18(30)16-22-26(24)35-27(38)29(22,33-15-7-10-25(32)37)21-8-5-6-9-23(21)31/h5-6,8-9,11-14,16-17,33H,3-4,7,10,15H2,1-2H3,(H2,32,37)(H,34,39)(H,35,38) |
| InChIKey | SSEJZHHXCIMLPB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|