C11H18N6O3S — CID 67817927
(2R)-2,5-diamino-N-(N'-nitrocarbamimidoyl)-N-(thiophen-2-ylmethyl)pentanamide (PubChem CID 67817927) has the molecular formula C11H18N6O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-(N'-nitrocarbamimidoyl)-N-(thiophen-2-ylmethyl)pentanamide.
| Compound Name | (2R)-2,5-diamino-N-(N'-nitrocarbamimidoyl)-N-(thiophen-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 67817927 |
| Molecular Formula | C11H18N6O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2R)-2,5-diamino-N-(N'-nitrocarbamimidoyl)-N-(thiophen-2-ylmethyl)pentanamide |
| SMILES | NCCC[C@@H](N)C(=O)N(Cc1cccs1)C(N)=N[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N6O3S/c12-5-1-4-9(13)10(18)16(11(14)15-17(19)20)7-8-3-2-6-21-8/h2-3,6,9H,1,4-5,7,12-13H2,(H2,14,15)/t9-/m1/s1 |
| InChIKey | AXTVYGDSQBQMQQ-SECBINFHSA-N |
| XLogP | -0.35 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|