C28H46O8S — CID 67820869
(1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol (PubChem CID 67820869) has the molecular formula C28H46O8S and a molecular weight of 542.74 g/mol. Its IUPAC name is (1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol.
| Compound Name | (1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol |
|---|---|
| PubChem CID | 67820869 |
| Molecular Formula | C28H46O8S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (1S)-1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-methylphenyl)sulfonylethanol |
| SMILES | CCCCCCCCCOCCCO[C@H]1O[C@H]([C@@](C)(O)S(=O)(=O)c2ccc(C)cc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C28H46O8S/c1-6-7-8-9-10-11-12-18-32-19-13-20-33-26-24-23(35-27(3,4)36-24)25(34-26)28(5,29)37(30,31)22-16-14-21(2)15-17-22/h14-17,23-26,29H,6-13,18-20H2,1-5H3/t23-,24+,25+,26+,28+/m1/s1 |
| InChIKey | KVQLYHDDDXONJJ-VETGFMSWSA-N |
| XLogP | 4.90 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|