C11H12O4 — CID 67823456
ethenyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 67823456) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is ethenyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate.
| Compound Name | ethenyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 67823456 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | ethenyl 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=COC(=O)C1C=CC=CC1(O)C(C)=O |
| InChI | InChI=1S/C11H12O4/c1-3-15-10(13)9-6-4-5-7-11(9,14)8(2)12/h3-7,9,14H,1H2,2H3 |
| InChIKey | SLXYWNWVMDAOPW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|