C29H40Cl2N4O6 — CID 67834824
5-O-[3-(4-but-2-ynylpiperazin-1-yl)-2,2-dimethylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride (PubChem CID 67834824) has the molecular formula C29H40Cl2N4O6 and a molecular weight of 611.57 g/mol. Its IUPAC name is 5-O-[3-(4-but-2-ynylpiperazin-1-yl)-2,2-dimethylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride.
| Compound Name | 5-O-[3-(4-but-2-ynylpiperazin-1-yl)-2,2-dimethylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride |
|---|---|
| PubChem CID | 67834824 |
| Molecular Formula | C29H40Cl2N4O6 |
| Molecular Weight | 611.57 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 5-O-[3-(4-but-2-ynylpiperazin-1-yl)-2,2-dimethylpropyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride |
| SMILES | CC#CCN1CCN(CC(C)(C)COC(=O)C2=C(C)NC(C)=C(C(=O)OC)C2c2cccc([N+](=O)[O-])c2)CC1.Cl.Cl |
| InChI | InChI=1S/C29H38N4O6.2ClH/c1-7-8-12-31-13-15-32(16-14-31)18-29(4,5)19-39-28(35)25-21(3)30-20(2)24(27(34)38-6)26(25)22-10-9-11-23(17-22)33(36)37;;/h9-11,17,26,30H,12-16,18-19H2,1-6H3;2*1H |
| InChIKey | JSZCZMYVBDYYHZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|