C41H62N6O6 — CID 67934675
bis[3,3-dimethyl-4-(4-prop-2-enylpiperazin-1-yl)butyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67934675) has the molecular formula C41H62N6O6 and a molecular weight of 734.98 g/mol. Its IUPAC name is bis[3,3-dimethyl-4-(4-prop-2-enylpiperazin-1-yl)butyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[3,3-dimethyl-4-(4-prop-2-enylpiperazin-1-yl)butyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67934675 |
| Molecular Formula | C41H62N6O6 |
| Molecular Weight | 734.98 g/mol |
| Exact Mass | 734.47 |
| IUPAC Name | bis[3,3-dimethyl-4-(4-prop-2-enylpiperazin-1-yl)butyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CCN1CCN(CC(C)(C)CCOC(=O)C2=C(C)NC(C)=C(C(=O)OCCC(C)(C)CN3CCN(CC=C)CC3)C2c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C41H62N6O6/c1-9-16-43-18-22-45(23-19-43)29-40(5,6)14-26-52-38(48)35-31(3)42-32(4)36(37(35)33-12-11-13-34(28-33)47(50)51)39(49)53-27-15-41(7,8)30-46-24-20-44(17-10-2)21-25-46/h9-13,28,37,42H,1-2,14-27,29-30H2,3-8H3 |
| InChIKey | UCTKKTLCYLKWOZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 120.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.98 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|