C16H17N5O9 — CID 67842068
2-[2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]but-2-enedioic acid (PubChem CID 67842068) has the molecular formula C16H17N5O9 and a molecular weight of 423.34 g/mol. Its IUPAC name is 2-[2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]but-2-enedioic acid.
| Compound Name | 2-[2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67842068 |
| Molecular Formula | C16H17N5O9 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-[2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]but-2-enedioic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)CC(=CC(=O)O)C(=O)O)C(O)C1O |
| InChI | InChI=1S/C16H17N5O9/c17-13-10-14(19-4-18-13)21(5-20-10)15-12(26)11(25)7(30-15)3-29-9(24)2-6(16(27)28)1-8(22)23/h1,4-5,7,11-12,15,25-26H,2-3H2,(H,22,23)(H,27,28)(H2,17,18,19)/t7-,11?,12?,15-/m1/s1 |
| InChIKey | ITYPENSXKIKNNR-PZOJCECCSA-N |
| XLogP | -1.94 |
| TPSA | 220.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|