About 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide
5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide (PubChem CID 67848766) has the molecular formula C11H9NO2S2
and a molecular weight of 251.33 g/mol. Its IUPAC name is 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide.
Analyze 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide?
The IUPAC name of 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide (CID 67848766) is 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide.
What is the SMILES notation for 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide?
The canonical SMILES for 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide is O=S1(=O)Nc2ccccc2Cc2sccc21.
What is the InChIKey of 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide?
The InChIKey is OCSUDTOOVUVDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2S2/c13-16(14)11-5-6-15-10(11)7-8-3-1-2-4-9(8)12-16/h1-6,12H,7H2.
What are the key properties of 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide?
5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide has a molecular weight of 251.33 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dihydrothieno[3,2-c][2,1]benzothiazepine 4,4-dioxide is sourced from PubChem (CID 67848766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).