C9H13NO2S — CID 54266090
1,3-dihydro-2,1-benzothiazole 2,2-dioxide;ethane (PubChem CID 54266090) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 1,3-dihydro-2,1-benzothiazole 2,2-dioxide;ethane.
| Compound Name | 1,3-dihydro-2,1-benzothiazole 2,2-dioxide;ethane |
|---|---|
| PubChem CID | 54266090 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1,3-dihydro-2,1-benzothiazole 2,2-dioxide;ethane |
| SMILES | CC.O=S1(=O)Cc2ccccc2N1 |
| InChI | InChI=1S/C7H7NO2S.C2H6/c9-11(10)5-6-3-1-2-4-7(6)8-11;1-2/h1-4,8H,5H2;1-2H3 |
| InChIKey | RGWMXJBKUIPQED-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |