C52H76N4 — CID 67852232
2,3,5,7-tetraoctylporphyrin (PubChem CID 67852232) has the molecular formula C52H76N4 and a molecular weight of 757.21 g/mol. Its IUPAC name is 2,3,5,7-tetraoctylporphyrin.
| Compound Name | 2,3,5,7-tetraoctylporphyrin |
|---|---|
| PubChem CID | 67852232 |
| Molecular Formula | C52H76N4 |
| Molecular Weight | 757.21 g/mol |
| Exact Mass | 756.61 |
| IUPAC Name | 2,3,5,7-tetraoctylporphyrin |
| SMILES | CCCCCCCCC1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/CCCCCCCC)C1=N2)C(CCCCCCCC)=C5CCCCCCCC)C=C4)C=C3 |
| InChI | InChI=1S/C52H76N4/c1-5-9-13-17-21-25-29-41-37-46-39-44-34-33-42(53-44)38-43-35-36-45(54-43)40-50-47(30-26-22-18-14-10-6-2)48(31-27-23-19-15-11-7-3)52(56-50)49(51(41)55-46)32-28-24-20-16-12-8-4/h33-40H,5-32H2,1-4H3/b42-38-,43-38-,44-39-,45-40-,46-39-,50-40-,51-49-,52-49- |
| InChIKey | SHJXJTMKQNHDFZ-BTDVWDRASA-N |
| XLogP | 16.06 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.21 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|