C39H48N2 — CID 58654979
4,5,9,10,14,15,19,20-octaethyl-24,25-diazahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaene (PubChem CID 58654979) has the molecular formula C39H48N2 and a molecular weight of 544.83 g/mol. Its IUPAC name is 4,5,9,10,14,15,19,20-octaethyl-24,25-diazahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaene.
| Compound Name | 4,5,9,10,14,15,19,20-octaethyl-24,25-diazahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaene |
|---|---|
| PubChem CID | 58654979 |
| Molecular Formula | C39H48N2 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | 4,5,9,10,14,15,19,20-octaethyl-24,25-diazahexacyclo[9.9.3.13,6.113,16.08,23.018,21]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaene |
| SMILES | CCC1=C(CC)/C2=C/C3=C(CC)C(CC)=C4/C=C5\N=C(/C=C6/C(CC)=C(CC)/C(=C/C1=N2)C6CC34)C(CC)=C5CC |
| InChI | InChI=1S/C39H48N2/c1-9-22-23(10-2)33-19-37-28(15-7)29(16-8)39(41-37)21-35-25(12-4)24(11-3)34-20-38-27(14-6)26(13-5)36(40-38)18-32(22)30(33)17-31(34)35/h18-21,30-31H,9-17H2,1-8H3/b32-18-,33-19-,34-20-,35-21-,36-18-,37-19-,38-20-,39-21- |
| InChIKey | WTOTYGNFTBGMMJ-RWAHCBIZSA-N |
| XLogP | 10.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |