About cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane
cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane (PubChem CID 67853175) has the molecular formula C13H26OS
and a molecular weight of 230.42 g/mol. Its IUPAC name is cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane.
Molecular Properties
| Compound Name | cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane |
| PubChem CID | 67853175 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane |
| SMILES | C1CCCC1.CCOC1(SC)CCCC1 |
| InChI | InChI=1S/C8H16OS.C5H10/c1-3-9-8(10-2)6-4-5-7-8;1-2-4-5-3-1/h3-7H2,1-2H3;1-5H2 |
| InChIKey | TUDBXDNZQNNPGD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane?
The IUPAC name of cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane (CID 67853175) is cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane.
What is the SMILES notation for cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane?
The canonical SMILES for cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane is C1CCCC1.CCOC1(SC)CCCC1.
What is the InChIKey of cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane?
The InChIKey is TUDBXDNZQNNPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS.C5H10/c1-3-9-8(10-2)6-4-5-7-8;1-2-4-5-3-1/h3-7H2,1-2H3;1-5H2.
What are the key properties of cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane?
cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane has a molecular weight of 230.42 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;1-ethoxy-1-methylsulfanylcyclopentane is sourced from PubChem (CID 67853175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).