C38H46N8O8 — CID 67857735
2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine;bis((E)-but-2-enedioic acid) (PubChem CID 67857735) has the molecular formula C38H46N8O8 and a molecular weight of 742.83 g/mol. Its IUPAC name is 2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine;bis((E)-but-2-enedioic acid).
| Compound Name | 2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 67857735 |
| Molecular Formula | C38H46N8O8 |
| Molecular Weight | 742.83 g/mol |
| Exact Mass | 742.34 |
| IUPAC Name | 2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine;bis((E)-but-2-enedioic acid) |
| SMILES | C=CCNc1nc(NCC=C)nc(NCCN2CCN(C3c4ccccc4CCc4ccccc43)CC2)n1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C30H38N8.2C4H4O4/c1-3-15-31-28-34-29(32-16-4-2)36-30(35-28)33-17-18-37-19-21-38(22-20-37)27-25-11-7-5-9-23(25)13-14-24-10-6-8-12-26(24)27;2*5-3(6)1-2-4(7)8/h3-12,27H,1-2,13-22H2,(H3,31,32,33,34,35,36);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | PEYWIHIDTYXQBT-LVEZLNDCSA-N |
| XLogP | 3.41 |
| TPSA | 230.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|