C17H22O4 — CID 67861601
[6-(2-methylprop-2-enoyloxy)-6-propylcyclohexa-2,4-dien-1-yl] 2-methylprop-2-enoate (PubChem CID 67861601) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [6-(2-methylprop-2-enoyloxy)-6-propylcyclohexa-2,4-dien-1-yl] 2-methylprop-2-enoate.
| Compound Name | [6-(2-methylprop-2-enoyloxy)-6-propylcyclohexa-2,4-dien-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67861601 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [6-(2-methylprop-2-enoyloxy)-6-propylcyclohexa-2,4-dien-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C=CC=CC1(CCC)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H22O4/c1-6-10-17(21-16(19)13(4)5)11-8-7-9-14(17)20-15(18)12(2)3/h7-9,11,14H,2,4,6,10H2,1,3,5H3 |
| InChIKey | NXMYOPCBHIGGMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|