C14H22Cl3NO8 — CID 67867682
2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-6,8-dihydroxy-7-(1-hydroxyethyl)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 67867682) has the molecular formula C14H22Cl3NO8 and a molecular weight of 438.69 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-6,8-dihydroxy-7-(1-hydroxyethyl)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-6,8-dihydroxy-7-(1-hydroxyethyl)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 67867682 |
| Molecular Formula | C14H22Cl3NO8 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(4aR,6S,7R,8R,8aS)-6,8-dihydroxy-7-(1-hydroxyethyl)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | CC(O)[C@]1(NC(=O)OCC(Cl)(Cl)Cl)[C@@H](O)O[C@@H]2COC(C)(C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C14H22Cl3NO8/c1-6(19)14(18-11(22)23-5-13(15,16)17)9(20)8-7(25-10(14)21)4-24-12(2,3)26-8/h6-10,19-21H,4-5H2,1-3H3,(H,18,22)/t6?,7-,8-,9+,10+,14-/m1/s1 |
| InChIKey | BFRRTTMQRLHZEK-BEMDQAOISA-N |
| XLogP | 0.43 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|