C23H26ClNO6 — CID 67872435
but-2-enedioic acid;5-chloro-6-[(4-methoxyphenyl)methoxy]-3-methyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 67872435) has the molecular formula C23H26ClNO6 and a molecular weight of 447.92 g/mol. Its IUPAC name is but-2-enedioic acid;5-chloro-6-[(4-methoxyphenyl)methoxy]-3-methyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | but-2-enedioic acid;5-chloro-6-[(4-methoxyphenyl)methoxy]-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 67872435 |
| Molecular Formula | C23H26ClNO6 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | but-2-enedioic acid;5-chloro-6-[(4-methoxyphenyl)methoxy]-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1ccc(COc2cccc3c2C(Cl)CN(C)CC3)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H22ClNO2.C4H4O4/c1-21-11-10-15-4-3-5-18(19(15)17(20)12-21)23-13-14-6-8-16(22-2)9-7-14;5-3(6)1-2-4(7)8/h3-9,17H,10-13H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | UDZDJGDQSANSKW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|