C23H20ClFN4O6 — CID 67896503
[8-chloro-1-cyclopropyl-6-fluoro-7-[2-(4-nitrophenyl)piperazin-1-yl]-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 67896503) has the molecular formula C23H20ClFN4O6 and a molecular weight of 502.89 g/mol. Its IUPAC name is [8-chloro-1-cyclopropyl-6-fluoro-7-[2-(4-nitrophenyl)piperazin-1-yl]-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [8-chloro-1-cyclopropyl-6-fluoro-7-[2-(4-nitrophenyl)piperazin-1-yl]-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67896503 |
| Molecular Formula | C23H20ClFN4O6 |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | [8-chloro-1-cyclopropyl-6-fluoro-7-[2-(4-nitrophenyl)piperazin-1-yl]-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cn(C2CC2)c2c(Cl)c(N3CCNCC3c3ccc([N+](=O)[O-])cc3)c(F)cc2c1=O |
| InChI | InChI=1S/C23H20ClFN4O6/c24-19-20-15(22(30)18(35-23(31)32)11-28(20)13-5-6-13)9-16(25)21(19)27-8-7-26-10-17(27)12-1-3-14(4-2-12)29(33)34/h1-4,9,11,13,17,26H,5-8,10H2,(H,31,32) |
| InChIKey | JEZIMMGDTGODDR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|