C11H13NO4S — CID 67907035
ethyl 4-hydroxysulfanyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carboxylate (PubChem CID 67907035) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is ethyl 4-hydroxysulfanyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl 4-hydroxysulfanyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67907035 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | ethyl 4-hydroxysulfanyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1SO)COCC2 |
| InChI | InChI=1S/C11H13NO4S/c1-2-16-11(13)7-5-12-9-3-4-15-6-8(9)10(7)17-14/h5,14H,2-4,6H2,1H3 |
| InChIKey | JAJVPUZQRUEJAB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|