C25H38ClNO7S — CID 67912183
tert-butyl 4-[2-[(4-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxymethyl]hept-6-enoate (PubChem CID 67912183) has the molecular formula C25H38ClNO7S and a molecular weight of 532.10 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxymethyl]hept-6-enoate.
| Compound Name | tert-butyl 4-[2-[(4-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxymethyl]hept-6-enoate |
|---|---|
| PubChem CID | 67912183 |
| Molecular Formula | C25H38ClNO7S |
| Molecular Weight | 532.10 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | tert-butyl 4-[2-[(4-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxymethyl]hept-6-enoate |
| SMILES | C=CCC(CCC(=O)OC(C)(C)C)COCCN(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H38ClNO7S/c1-8-9-19(10-15-22(28)33-24(2,3)4)18-32-17-16-27(23(29)34-25(5,6)7)35(30,31)21-13-11-20(26)12-14-21/h8,11-14,19H,1,9-10,15-18H2,2-7H3 |
| InChIKey | DSUQTFSTXBOLAT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.10 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|