C24H31N3O2 — CID 67912500
2,6-diamino-1-[7-[2-(methylamino)-3-phenylpropanoyl]-7-bicyclo[4.2.0]octa-1,3,5-trienyl]hexan-1-one (PubChem CID 67912500) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2,6-diamino-1-[7-[2-(methylamino)-3-phenylpropanoyl]-7-bicyclo[4.2.0]octa-1,3,5-trienyl]hexan-1-one.
| Compound Name | 2,6-diamino-1-[7-[2-(methylamino)-3-phenylpropanoyl]-7-bicyclo[4.2.0]octa-1,3,5-trienyl]hexan-1-one |
|---|---|
| PubChem CID | 67912500 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 2,6-diamino-1-[7-[2-(methylamino)-3-phenylpropanoyl]-7-bicyclo[4.2.0]octa-1,3,5-trienyl]hexan-1-one |
| SMILES | CNC(Cc1ccccc1)C(=O)C1(C(=O)C(N)CCCCN)Cc2ccccc21 |
| InChI | InChI=1S/C24H31N3O2/c1-27-21(15-17-9-3-2-4-10-17)23(29)24(16-18-11-5-6-12-19(18)24)22(28)20(26)13-7-8-14-25/h2-6,9-12,20-21,27H,7-8,13-16,25-26H2,1H3 |
| InChIKey | FRPACOZCTZQXSP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|