C23H35N5O6 — CID 67922944
4-amino-2-ethoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]-5-nitrobenzamide (PubChem CID 67922944) has the molecular formula C23H35N5O6 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-amino-2-ethoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]-5-nitrobenzamide.
| Compound Name | 4-amino-2-ethoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 67922944 |
| Molecular Formula | C23H35N5O6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 4-amino-2-ethoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]-5-nitrobenzamide |
| SMILES | CCOc1cc(N)c([N+](=O)[O-])cc1C(=O)N[C@H]1CCN(CCCC(=O)N2CCCC2)C[C@H]1OC |
| InChI | InChI=1S/C23H35N5O6/c1-3-34-20-14-17(24)19(28(31)32)13-16(20)23(30)25-18-8-12-26(15-21(18)33-2)9-6-7-22(29)27-10-4-5-11-27/h13-14,18,21H,3-12,15,24H2,1-2H3,(H,25,30)/t18-,21+/m0/s1 |
| InChIKey | IJFRKUSWOQKQRJ-GHTZIAJQSA-N |
| XLogP | 1.80 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|