C17H22ClN3O7 — CID 67928767
ethyl (3R,4S)-4-[(4-chloro-2-methoxy-5-nitrobenzoyl)amino]-3-methoxypiperidine-1-carboxylate (PubChem CID 67928767) has the molecular formula C17H22ClN3O7 and a molecular weight of 415.83 g/mol. Its IUPAC name is ethyl (3R,4S)-4-[(4-chloro-2-methoxy-5-nitrobenzoyl)amino]-3-methoxypiperidine-1-carboxylate.
| Compound Name | ethyl (3R,4S)-4-[(4-chloro-2-methoxy-5-nitrobenzoyl)amino]-3-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67928767 |
| Molecular Formula | C17H22ClN3O7 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | ethyl (3R,4S)-4-[(4-chloro-2-methoxy-5-nitrobenzoyl)amino]-3-methoxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@H](NC(=O)c2cc([N+](=O)[O-])c(Cl)cc2OC)[C@H](OC)C1 |
| InChI | InChI=1S/C17H22ClN3O7/c1-4-28-17(23)20-6-5-12(15(9-20)27-3)19-16(22)10-7-13(21(24)25)11(18)8-14(10)26-2/h7-8,12,15H,4-6,9H2,1-3H3,(H,19,22)/t12-,15+/m0/s1 |
| InChIKey | GKVCCRULWCCGDO-SWLSCSKDSA-N |
| XLogP | 2.23 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|